C17H24N2O — CID 79860273
4-[(2,2-dimethylcyclopentyl)amino]-N-prop-2-enylbenzamide (PubChem CID 79860273) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-[(2,2-dimethylcyclopentyl)amino]-N-prop-2-enylbenzamide.
| Compound Name | 4-[(2,2-dimethylcyclopentyl)amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 79860273 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-[(2,2-dimethylcyclopentyl)amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(NC2CCCC2(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-4-12-18-16(20)13-7-9-14(10-8-13)19-15-6-5-11-17(15,2)3/h4,7-10,15,19H,1,5-6,11-12H2,2-3H3,(H,18,20) |
| InChIKey | IMECUADRNDNSHI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|