C17H23N3O — CID 82823800
4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N-prop-2-enylbenzamide (PubChem CID 82823800) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N-prop-2-enylbenzamide.
| Compound Name | 4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 82823800 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(NC2CCN3CCCC23)cc1 |
| InChI | InChI=1S/C17H23N3O/c1-2-10-18-17(21)13-5-7-14(8-6-13)19-15-9-12-20-11-3-4-16(15)20/h2,5-8,15-16,19H,1,3-4,9-12H2,(H,18,21) |
| InChIKey | SDEYWEYYQXQHHW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|