C18H23N3O3 — CID 155945860
N-cyclohexyl-N'-[4-(prop-2-enylcarbamoyl)phenyl]oxamide (PubChem CID 155945860) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-cyclohexyl-N'-[4-(prop-2-enylcarbamoyl)phenyl]oxamide.
| Compound Name | N-cyclohexyl-N'-[4-(prop-2-enylcarbamoyl)phenyl]oxamide |
|---|---|
| PubChem CID | 155945860 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-cyclohexyl-N'-[4-(prop-2-enylcarbamoyl)phenyl]oxamide |
| SMILES | C=CCNC(=O)c1ccc(NC(=O)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-2-12-19-16(22)13-8-10-15(11-9-13)21-18(24)17(23)20-14-6-4-3-5-7-14/h2,8-11,14H,1,3-7,12H2,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | ZOZQJOIIMPIPCO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|