C15H5ClF16N2O3 — CID 4058445
N-(2-chloro-5-nitrophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide (PubChem CID 4058445) has the molecular formula C15H5ClF16N2O3 and a molecular weight of 600.64 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
|---|---|
| PubChem CID | 4058445 |
| Molecular Formula | C15H5ClF16N2O3 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 599.97 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H5ClF16N2O3/c16-5-2-1-4(34(36)37)3-6(5)33-8(35)10(21,22)12(25,26)14(29,30)15(31,32)13(27,28)11(23,24)9(19,20)7(17)18/h1-3,7H,(H,33,35) |
| InChIKey | FUJYIGXISJVGJJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|