C14H8F12N2O4 — CID 5172635
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(2-methoxy-4-nitrophenyl)heptanamide (PubChem CID 5172635) has the molecular formula C14H8F12N2O4 and a molecular weight of 496.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(2-methoxy-4-nitrophenyl)heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(2-methoxy-4-nitrophenyl)heptanamide |
|---|---|
| PubChem CID | 5172635 |
| Molecular Formula | C14H8F12N2O4 |
| Molecular Weight | 496.20 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(2-methoxy-4-nitrophenyl)heptanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H8F12N2O4/c1-32-7-4-5(28(30)31)2-3-6(7)27-9(29)11(19,20)13(23,24)14(25,26)12(21,22)10(17,18)8(15)16/h2-4,8H,1H3,(H,27,29) |
| InChIKey | CUWSIXQOCSYBQU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|