C12H7F9N2O4 — CID 4102535
2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methoxy-2-nitrophenyl)pentanamide (PubChem CID 4102535) has the molecular formula C12H7F9N2O4 and a molecular weight of 414.18 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methoxy-2-nitrophenyl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methoxy-2-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 4102535 |
| Molecular Formula | C12H7F9N2O4 |
| Molecular Weight | 414.18 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(4-methoxy-2-nitrophenyl)pentanamide |
| SMILES | COc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H7F9N2O4/c1-27-5-2-3-6(7(4-5)23(25)26)22-8(24)9(13,14)10(15,16)11(17,18)12(19,20)21/h2-4H,1H3,(H,22,24) |
| InChIKey | AMUSYEPRTLRHCV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|