C12H9F7N2O5 — CID 3109819
N-(4-ethoxy-2-nitrophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide (PubChem CID 3109819) has the molecular formula C12H9F7N2O5 and a molecular weight of 394.20 g/mol. Its IUPAC name is N-(4-ethoxy-2-nitrophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide.
| Compound Name | N-(4-ethoxy-2-nitrophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide |
|---|---|
| PubChem CID | 3109819 |
| Molecular Formula | C12H9F7N2O5 |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-(4-ethoxy-2-nitrophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide |
| SMILES | CCOc1ccc(NC(=O)C(F)(F)C(F)(F)OC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9F7N2O5/c1-2-25-6-3-4-7(8(5-6)21(23)24)20-9(22)10(13,14)11(15,16)26-12(17,18)19/h3-5H,2H2,1H3,(H,20,22) |
| InChIKey | RDUYWCUSUSAGTA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|