C15H10F13NO3 — CID 19177842
N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 19177842) has the molecular formula C15H10F13NO3 and a molecular weight of 499.22 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 19177842 |
| Molecular Formula | C15H10F13NO3 |
| Molecular Weight | 499.22 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | COc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C15H10F13NO3/c1-31-6-3-4-7(8(5-6)32-2)29-9(30)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h3-5H,1-2H3,(H,29,30) |
| InChIKey | GAXNXUMTRMNYJT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.22 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|