C15H7F17N2O3 — CID 163144098
3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)-N-hydroxybenzeneamine oxide (PubChem CID 163144098) has the molecular formula C15H7F17N2O3 and a molecular weight of 586.20 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)-N-hydroxybenzeneamine oxide.
| Compound Name | 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163144098 |
| Molecular Formula | C15H7F17N2O3 |
| Molecular Weight | 586.20 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)-N-hydroxybenzeneamine oxide |
| SMILES | O=C(Nc1cccc([NH+]([O-])O)c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H7F17N2O3/c16-8(17,7(35)33-5-2-1-3-6(4-5)34(36)37)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h1-4,34,36H,(H,33,35) |
| InChIKey | KWJPGGHCYHRUKJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|