C24H14F18N2O2 — CID 4152473
2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-methyl-4-[3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]phenyl]pentanamide (PubChem CID 4152473) has the molecular formula C24H14F18N2O2 and a molecular weight of 704.35 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-methyl-4-[3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]phenyl]pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-methyl-4-[3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 4152473 |
| Molecular Formula | C24H14F18N2O2 |
| Molecular Weight | 704.35 g/mol |
| Exact Mass | 704.08 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-methyl-4-[3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]phenyl]pentanamide |
| SMILES | Cc1cc(-c2ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C)c2)ccc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H14F18N2O2/c1-9-7-11(3-5-13(9)43-15(45)17(25,26)19(29,30)21(33,34)23(37,38)39)12-4-6-14(10(2)8-12)44-16(46)18(27,28)20(31,32)22(35,36)24(40,41)42/h3-8H,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | PTBVSZGPPZWSFU-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.35 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|