C11H4BrF9N2O3 — CID 22163192
N-(2-bromo-4-nitrophenyl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide (PubChem CID 22163192) has the molecular formula C11H4BrF9N2O3 and a molecular weight of 463.05 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide.
| Compound Name | N-(2-bromo-4-nitrophenyl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 22163192 |
| Molecular Formula | C11H4BrF9N2O3 |
| Molecular Weight | 463.05 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Br)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H4BrF9N2O3/c12-5-3-4(23(25)26)1-2-6(5)22-7(24)8(9(13,14)15,10(16,17)18)11(19,20)21/h1-3H,(H,22,24) |
| InChIKey | ULERVLJIEXEVHN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|