C10H4BrF4N3O3 — CID 22163208
N-(2-bromo-4-nitrophenyl)-2-cyano-2,3,3,3-tetrafluoropropanamide (PubChem CID 22163208) has the molecular formula C10H4BrF4N3O3 and a molecular weight of 370.06 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-2-cyano-2,3,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-bromo-4-nitrophenyl)-2-cyano-2,3,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 22163208 |
| Molecular Formula | C10H4BrF4N3O3 |
| Molecular Weight | 370.06 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-2-cyano-2,3,3,3-tetrafluoropropanamide |
| SMILES | N#CC(F)(C(=O)Nc1ccc([N+](=O)[O-])cc1Br)C(F)(F)F |
| InChI | InChI=1S/C10H4BrF4N3O3/c11-6-3-5(18(20)21)1-2-7(6)17-8(19)9(12,4-16)10(13,14)15/h1-3H,(H,17,19) |
| InChIKey | IDOLHHHNBSCYLH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.06 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|