C9H4BrF5N2O3 — CID 15402155
N-(2-bromo-4-nitrophenyl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 15402155) has the molecular formula C9H4BrF5N2O3 and a molecular weight of 363.04 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(2-bromo-4-nitrophenyl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 15402155 |
| Molecular Formula | C9H4BrF5N2O3 |
| Molecular Weight | 363.04 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4BrF5N2O3/c10-5-3-4(17(19)20)1-2-6(5)16-7(18)8(11,12)9(13,14)15/h1-3H,(H,16,18) |
| InChIKey | PBXUXHUNALFWEV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.04 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|