C11H4F7N3O3 — CID 14577518
N-(2-cyano-4-nitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide (PubChem CID 14577518) has the molecular formula C11H4F7N3O3 and a molecular weight of 359.16 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 14577518 |
| Molecular Formula | C11H4F7N3O3 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H4F7N3O3/c12-9(10(13,14)15,11(16,17)18)8(22)20-7-2-1-6(21(23)24)3-5(7)4-19/h1-3H,(H,20,22) |
| InChIKey | RPEXYCMKOHSRMV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|