C19H13BrF10N2O2 — CID 155045728
4-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(ethylamino)-2-fluorobenzamide (PubChem CID 155045728) has the molecular formula C19H13BrF10N2O2 and a molecular weight of 571.21 g/mol. Its IUPAC name is 4-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(ethylamino)-2-fluorobenzamide.
| Compound Name | 4-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(ethylamino)-2-fluorobenzamide |
|---|---|
| PubChem CID | 155045728 |
| Molecular Formula | C19H13BrF10N2O2 |
| Molecular Weight | 571.21 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | 4-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-(ethylamino)-2-fluorobenzamide |
| SMILES | CCNc1c(-c2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)ccc(C(N)=O)c1F |
| InChI | InChI=1S/C19H13BrF10N2O2/c1-2-32-14-8(3-4-9(13(14)21)15(31)33)12-10(20)5-7(6-11(12)34-16(22)23)17(24,18(25,26)27)19(28,29)30/h3-6,16,32H,2H2,1H3,(H2,31,33) |
| InChIKey | OYLJNWUFYAVRJD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.21 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |