C8H5Br2F2NO2 — CID 118851773
4,5-dibromo-2-(difluoromethoxy)benzamide (PubChem CID 118851773) has the molecular formula C8H5Br2F2NO2 and a molecular weight of 344.94 g/mol. Its IUPAC name is 4,5-dibromo-2-(difluoromethoxy)benzamide.
| Compound Name | 4,5-dibromo-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 118851773 |
| Molecular Formula | C8H5Br2F2NO2 |
| Molecular Weight | 344.94 g/mol |
| Exact Mass | 342.87 |
| IUPAC Name | 4,5-dibromo-2-(difluoromethoxy)benzamide |
| SMILES | NC(=O)c1cc(Br)c(Br)cc1OC(F)F |
| InChI | InChI=1S/C8H5Br2F2NO2/c9-4-1-3(7(13)14)6(2-5(4)10)15-8(11)12/h1-2,8H,(H2,13,14) |
| InChIKey | NICZQSUMTVQTOH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.94 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |