C7H5Br2F2NO3S — CID 118852223
4,5-dibromo-2-(difluoromethoxy)benzenesulfonamide (PubChem CID 118852223) has the molecular formula C7H5Br2F2NO3S and a molecular weight of 380.99 g/mol. Its IUPAC name is 4,5-dibromo-2-(difluoromethoxy)benzenesulfonamide.
| Compound Name | 4,5-dibromo-2-(difluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 118852223 |
| Molecular Formula | C7H5Br2F2NO3S |
| Molecular Weight | 380.99 g/mol |
| Exact Mass | 378.83 |
| IUPAC Name | 4,5-dibromo-2-(difluoromethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)c(Br)cc1OC(F)F |
| InChI | InChI=1S/C7H5Br2F2NO3S/c8-3-1-5(15-7(10)11)6(2-4(3)9)16(12,13)14/h1-2,7H,(H2,12,13,14) |
| InChIKey | QHXUKURIIIADMM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.99 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |