C15H14F2N2O5S2 — CID 68787125
2-[2-[2-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide (PubChem CID 68787125) has the molecular formula C15H14F2N2O5S2 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide.
| Compound Name | 2-[2-[2-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 68787125 |
| Molecular Formula | C15H14F2N2O5S2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NS(=O)(=O)C=Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H14F2N2O5S2/c16-15(17)24-13-7-3-1-5-11(13)9-10-25(20,21)19-12-6-2-4-8-14(12)26(18,22)23/h1-10,15,19H,(H2,18,22,23) |
| InChIKey | CQCPXFXCGALQJM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |