C14H14N2O4S2 — CID 6186872
2-[(E)-2-(2-sulfamoylphenyl)ethenyl]benzenesulfonamide (PubChem CID 6186872) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[(E)-2-(2-sulfamoylphenyl)ethenyl]benzenesulfonamide.
| Compound Name | 2-[(E)-2-(2-sulfamoylphenyl)ethenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6186872 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-[(E)-2-(2-sulfamoylphenyl)ethenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1/C=C/c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H14N2O4S2/c15-21(17,18)13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)22(16,19)20/h1-10H,(H2,15,17,18)(H2,16,19,20)/b10-9+ |
| InChIKey | DYIVXJTVYOACKX-MDZDMXLPSA-N |
| XLogP | 1.15 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|