C12H17NO2S — CID 157318662
2-(3,3-dimethylbut-1-enyl)benzenesulfonamide (PubChem CID 157318662) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(3,3-dimethylbut-1-enyl)benzenesulfonamide.
| Compound Name | 2-(3,3-dimethylbut-1-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 157318662 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(3,3-dimethylbut-1-enyl)benzenesulfonamide |
| SMILES | CC(C)(C)C=Cc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H17NO2S/c1-12(2,3)9-8-10-6-4-5-7-11(10)16(13,14)15/h4-9H,1-3H3,(H2,13,14,15) |
| InChIKey | HAAZYALIEGPNLK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |