C13H17NS — CID 143253909
N-[2-[(Z)-3,3-dimethylbut-1-enyl]phenyl]methanethioamide (PubChem CID 143253909) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is N-[2-[(Z)-3,3-dimethylbut-1-enyl]phenyl]methanethioamide.
| Compound Name | N-[2-[(Z)-3,3-dimethylbut-1-enyl]phenyl]methanethioamide |
|---|---|
| PubChem CID | 143253909 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[2-[(Z)-3,3-dimethylbut-1-enyl]phenyl]methanethioamide |
| SMILES | CC(C)(C)/C=C\c1ccccc1NC=S |
| InChI | InChI=1S/C13H17NS/c1-13(2,3)9-8-11-6-4-5-7-12(11)14-10-15/h4-10H,1-3H3,(H,14,15)/b9-8- |
| InChIKey | YBIUZAXGFMNKAR-HJWRWDBZSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|