C16H17NO — CID 145359628
N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide (PubChem CID 145359628) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide.
| Compound Name | N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide |
|---|---|
| PubChem CID | 145359628 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide |
| SMILES | C=C/C(C)=C(C=C)/C=C\c1ccccc1NC=O |
| InChI | InChI=1S/C16H17NO/c1-4-13(3)14(5-2)10-11-15-8-6-7-9-16(15)17-12-18/h4-12H,1-2H2,3H3,(H,17,18)/b11-10-,14-13+ |
| InChIKey | YAJOCIPMMMAKIK-SEGPTZFDSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|