C24H32N2 — CID 170614649
N-ethenyl-2-[(1Z,3E)-3-ethenyl-8-(ethylamino)-4-[(Z)-prop-1-enyl]nona-1,3,8-trienyl]aniline (PubChem CID 170614649) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is N-ethenyl-2-[(1Z,3E)-3-ethenyl-8-(ethylamino)-4-[(Z)-prop-1-enyl]nona-1,3,8-trienyl]aniline.
| Compound Name | N-ethenyl-2-[(1Z,3E)-3-ethenyl-8-(ethylamino)-4-[(Z)-prop-1-enyl]nona-1,3,8-trienyl]aniline |
|---|---|
| PubChem CID | 170614649 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N-ethenyl-2-[(1Z,3E)-3-ethenyl-8-(ethylamino)-4-[(Z)-prop-1-enyl]nona-1,3,8-trienyl]aniline |
| SMILES | C=CNc1ccccc1/C=C\C(C=C)=C(\C=C/C)CCCC(=C)NCC |
| InChI | InChI=1S/C24H32N2/c1-6-13-22(16-12-14-20(5)25-8-3)21(7-2)18-19-23-15-10-11-17-24(23)26-9-4/h6-7,9-11,13,15,17-19,25-26H,2,4-5,8,12,14,16H2,1,3H3/b13-6-,19-18-,22-21- |
| InChIKey | UQMPZKHSDJBAEA-HDEHNVETSA-N |
| XLogP | 6.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|