C18H23NO — CID 145359627
ethane;N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide (PubChem CID 145359627) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is ethane;N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide.
| Compound Name | ethane;N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide |
|---|---|
| PubChem CID | 145359627 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | ethane;N-[2-[(1Z,3E)-3-ethenyl-4-methylhexa-1,3,5-trienyl]phenyl]formamide |
| SMILES | C=C/C(C)=C(C=C)/C=C\c1ccccc1NC=O.CC |
| InChI | InChI=1S/C16H17NO.C2H6/c1-4-13(3)14(5-2)10-11-15-8-6-7-9-16(15)17-12-18;1-2/h4-12H,1-2H2,3H3,(H,17,18);1-2H3/b11-10-,14-13+; |
| InChIKey | HSSGNDLSMLKTNO-UFJWGXCDSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|