About thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate
thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate (PubChem CID 175056698) has the molecular formula C16H10N2O6S4
and a molecular weight of 454.53 g/mol. Its IUPAC name is thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate.
Molecular Properties
| Compound Name | thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate |
| PubChem CID | 175056698 |
| Molecular Formula | C16H10N2O6S4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate |
| SMILES | N#CSOS(=O)(=O)c1ccccc1C=Cc1ccccc1S(=O)(=O)OSC#N |
| InChI | InChI=1S/C16H10N2O6S4/c17-11-25-23-27(19,20)15-7-3-1-5-13(15)9-10-14-6-2-4-8-16(14)28(21,22)24-26-12-18/h1-10H |
| InChIKey | AHQONNNQCYJVTD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 134.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate?
The IUPAC name of thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate (CID 175056698) is thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate.
What is the SMILES notation for thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate?
The canonical SMILES for thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate is N#CSOS(=O)(=O)c1ccccc1C=Cc1ccccc1S(=O)(=O)OSC#N.
What is the InChIKey of thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate?
The InChIKey is AHQONNNQCYJVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O6S4/c17-11-25-23-27(19,20)15-7-3-1-5-13(15)9-10-14-6-2-4-8-16(14)28(21,22)24-26-12-18/h1-10H.
What are the key properties of thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate?
thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate has a molecular weight of 454.53 g/mol, XLogP of 3.53, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for thiocyanato 2-[2-(2-thiocyanatooxysulfonylphenyl)ethenyl]benzenesulfonate is sourced from PubChem (CID 175056698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).