C7H3Br2ClF2O3S — CID 131266855
2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride (PubChem CID 131266855) has the molecular formula C7H3Br2ClF2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride.
| Compound Name | 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 131266855 |
| Molecular Formula | C7H3Br2ClF2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 397.78 |
| IUPAC Name | 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(OC(F)F)c(Br)cc1Br |
| InChI | InChI=1S/C7H3Br2ClF2O3S/c8-3-1-4(9)6(16(10,13)14)2-5(3)15-7(11)12/h1-2,7H |
| InChIKey | YSIYVCDXZNGIRL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |