2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride

C7H3Br2ClF2O3S — CID 131266855

IUPAC2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(OC(F)F)c(Br)cc1Br
InChIInChI=1S/C7H3Br2ClF2O3S/c8-3-1-4(9)6(16(10,13)14)2-5(3)15-7(11)12/h1-2,7H
InChIKeyYSIYVCDXZNGIRL-UHFFFAOYSA-N
MW400.42 g/mol
LogP3.74
Rot. Bonds3

About 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride

2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride (PubChem CID 131266855) has the molecular formula C7H3Br2ClF2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride
PubChem CID131266855
Molecular FormulaC7H3Br2ClF2O3S
Molecular Weight400.42 g/mol
Exact Mass397.78
IUPAC Name2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(OC(F)F)c(Br)cc1Br
InChIInChI=1S/C7H3Br2ClF2O3S/c8-3-1-4(9)6(16(10,13)14)2-5(3)15-7(11)12/h1-2,7H
InChIKeyYSIYVCDXZNGIRL-UHFFFAOYSA-N
XLogP3.74
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500400.42
LogP ≤ 53.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride?
The IUPAC name of 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride (CID 131266855) is 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride.
What is the SMILES notation for 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride?
The canonical SMILES for 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride is O=S(=O)(Cl)c1cc(OC(F)F)c(Br)cc1Br.
What is the InChIKey of 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride?
The InChIKey is YSIYVCDXZNGIRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Br2ClF2O3S/c8-3-1-4(9)6(16(10,13)14)2-5(3)15-7(11)12/h1-2,7H.
What are the key properties of 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride?
2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride has a molecular weight of 400.42 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-5-(difluoromethoxy)benzenesulfonyl chloride is sourced from PubChem (CID 131266855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).