C26H13BrClF10N3O3 — CID 146259292
N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[(2-chloro-4-fluorobenzoyl)-methylamino]-4-cyanobenzamide (PubChem CID 146259292) has the molecular formula C26H13BrClF10N3O3 and a molecular weight of 720.74 g/mol. Its IUPAC name is N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[(2-chloro-4-fluorobenzoyl)-methylamino]-4-cyanobenzamide.
| Compound Name | N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[(2-chloro-4-fluorobenzoyl)-methylamino]-4-cyanobenzamide |
|---|---|
| PubChem CID | 146259292 |
| Molecular Formula | C26H13BrClF10N3O3 |
| Molecular Weight | 720.74 g/mol |
| Exact Mass | 718.97 |
| IUPAC Name | N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[(2-chloro-4-fluorobenzoyl)-methylamino]-4-cyanobenzamide |
| SMILES | CN(C(=O)c1ccc(F)cc1Cl)c1cc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)ccc1C#N |
| InChI | InChI=1S/C26H13BrClF10N3O3/c1-41(22(43)15-5-4-14(29)9-17(15)28)18-6-11(2-3-12(18)10-39)21(42)40-20-16(27)7-13(8-19(20)44-23(30)31)24(32,25(33,34)35)26(36,37)38/h2-9,23H,1H3,(H,40,42) |
| InChIKey | DVGUOVYACHWTEP-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.74 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |