C21H10BrF11N2O3 — CID 89106080
N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide (PubChem CID 89106080) has the molecular formula C21H10BrF11N2O3 and a molecular weight of 627.20 g/mol. Its IUPAC name is N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide.
| Compound Name | N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 89106080 |
| Molecular Formula | C21H10BrF11N2O3 |
| Molecular Weight | 627.20 g/mol |
| Exact Mass | 625.97 |
| IUPAC Name | N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1OC(F)F)c1ccc2ccc[n+]([O-])c2c1 |
| InChI | InChI=1S/C21H10BrF11N2O3/c22-12-7-11(18(25,20(28,29)30)19(26,27)21(31,32)33)8-14(38-17(23)24)15(12)34-16(36)10-4-3-9-2-1-5-35(37)13(9)6-10/h1-8,17H,(H,34,36) |
| InChIKey | VMNFZKXUPQXQLM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.20 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|