C20H9BrF10N2O3 — CID 89106115
N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide (PubChem CID 89106115) has the molecular formula C20H9BrF10N2O3 and a molecular weight of 595.19 g/mol. Its IUPAC name is N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide.
| Compound Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 89106115 |
| Molecular Formula | C20H9BrF10N2O3 |
| Molecular Weight | 595.19 g/mol |
| Exact Mass | 593.96 |
| IUPAC Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1OC(F)(F)F)c1ccc2ccc[n+]([O-])c2c1 |
| InChI | InChI=1S/C20H9BrF10N2O3/c21-12-7-11(17(22,18(23,24)25)19(26,27)28)8-14(36-20(29,30)31)15(12)32-16(34)10-4-3-9-2-1-5-33(35)13(9)6-10/h1-8H,(H,32,34) |
| InChIKey | SYWBAVZWEUMCSV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.19 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|