C20H9BrClF9N2O2S — CID 89106142
N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide (PubChem CID 89106142) has the molecular formula C20H9BrClF9N2O2S and a molecular weight of 627.71 g/mol. Its IUPAC name is N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide.
| Compound Name | N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 89106142 |
| Molecular Formula | C20H9BrClF9N2O2S |
| Molecular Weight | 627.71 g/mol |
| Exact Mass | 625.91 |
| IUPAC Name | N-[4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)Br)cc1SC(F)(F)F)c1ccc2ccc[n+]([O-])c2c1 |
| InChI | InChI=1S/C20H9BrClF9N2O2S/c21-18(24,25)17(23,19(26,27)28)11-7-12(22)15(14(8-11)36-20(29,30)31)32-16(34)10-4-3-9-2-1-5-33(35)13(9)6-10/h1-8H,(H,32,34) |
| InChIKey | QCTBWRAQKNEPEE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|