C24H13BrF10N2O4 — CID 149093523
N-[3-[2-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 149093523) has the molecular formula C24H13BrF10N2O4 and a molecular weight of 663.26 g/mol. Its IUPAC name is N-[3-[2-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[3-[2-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 149093523 |
| Molecular Formula | C24H13BrF10N2O4 |
| Molecular Weight | 663.26 g/mol |
| Exact Mass | 661.99 |
| IUPAC Name | N-[3-[2-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)Cc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)c1F)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C24H13BrF10N2O4/c25-15-8-12(22(29,23(30,31)32)24(33,34)35)9-18(41-21(27)28)14(15)10-17(38)13-2-1-3-16(19(13)26)36-20(39)11-4-6-37(40)7-5-11/h1-9,21H,10H2,(H,36,39) |
| InChIKey | QSYRZVUGKGQTPA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.26 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|