C26H16F9N3O5 — CID 155051797
3-[(4-cyanobenzoyl)amino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-hydroxyphenyl]-2-methoxybenzamide (PubChem CID 155051797) has the molecular formula C26H16F9N3O5 and a molecular weight of 621.41 g/mol. Its IUPAC name is 3-[(4-cyanobenzoyl)amino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-hydroxyphenyl]-2-methoxybenzamide.
| Compound Name | 3-[(4-cyanobenzoyl)amino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-hydroxyphenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 155051797 |
| Molecular Formula | C26H16F9N3O5 |
| Molecular Weight | 621.41 g/mol |
| Exact Mass | 621.09 |
| IUPAC Name | 3-[(4-cyanobenzoyl)amino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-hydroxyphenyl]-2-methoxybenzamide |
| SMILES | COc1c(NC(=O)c2ccc(C#N)cc2)cccc1C(=O)Nc1c(O)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C26H16F9N3O5/c1-42-20-15(3-2-4-16(20)37-21(40)13-7-5-12(11-36)6-8-13)22(41)38-19-17(39)9-14(10-18(19)43-23(27)28)24(29,25(30,31)32)26(33,34)35/h2-10,23,39H,1H3,(H,37,40)(H,38,41) |
| InChIKey | NDKBHABGWJGMDQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.41 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|