C26H11BF13N3O2 — CID 162561475
CID 162561475 (PubChem CID 162561475) has the molecular formula C26H11BF13N3O2 and a molecular weight of 655.18 g/mol.
| Compound Name | CID 162561475 |
|---|---|
| PubChem CID | 162561475 |
| Molecular Formula | C26H11BF13N3O2 |
| Molecular Weight | 655.18 g/mol |
| Exact Mass | 655.07 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)C(F)(F)F)c1NC(=O)c1cccc(NC(=O)c2ccc(C#N)cc2)c1F |
| InChI | InChI=1S/C26H11BF13N3O2/c27-16-9-13(22(29,24(32,33)34)25(35,36)37)8-15(23(30,31)26(38,39)40)19(16)43-21(45)14-2-1-3-17(18(14)28)42-20(44)12-6-4-11(10-41)5-7-12/h1-9H,(H,42,44)(H,43,45) |
| InChIKey | JLBAKGXCRVIKFR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.18 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|