C16H10F5NO3 — CID 126822242
2-[[4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]benzoic acid (PubChem CID 126822242) has the molecular formula C16H10F5NO3 and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-[[4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]benzoic acid.
| Compound Name | 2-[[4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 126822242 |
| Molecular Formula | C16H10F5NO3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-[[4-(1,1,2,2,2-pentafluoroethyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F5NO3/c17-15(18,16(19,20)21)10-7-5-9(6-8-10)13(23)22-12-4-2-1-3-11(12)14(24)25/h1-8H,(H,22,23)(H,24,25) |
| InChIKey | UIZKEGJRLOORGK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|