C25H15F11N2O2 — CID 162620992
3-benzamido-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide (PubChem CID 162620992) has the molecular formula C25H15F11N2O2 and a molecular weight of 584.39 g/mol. Its IUPAC name is 3-benzamido-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-benzamido-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 162620992 |
| Molecular Formula | C25H15F11N2O2 |
| Molecular Weight | 584.39 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | 3-benzamido-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1NC(=O)c1cccc(NC(=O)c2ccccc2)c1F |
| InChI | InChI=1S/C25H15F11N2O2/c1-12-10-14(22(27,24(31,32)33)25(34,35)36)11-16(23(28,29)30)19(12)38-21(40)15-8-5-9-17(18(15)26)37-20(39)13-6-3-2-4-7-13/h2-11H,1H3,(H,37,39)(H,38,40) |
| InChIKey | BSEVEVDVTKSKNR-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.39 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |