C25H16F13N3O2 — CID 143940757
N-[4-[1-(difluoroamino)-1,2,2,2-tetrafluoroethyl]-2,6-bis(trifluoromethyl)phenyl]formamide;N-(2-fluoro-3-methylphenyl)benzamide (PubChem CID 143940757) has the molecular formula C25H16F13N3O2 and a molecular weight of 637.40 g/mol. Its IUPAC name is N-[4-[1-(difluoroamino)-1,2,2,2-tetrafluoroethyl]-2,6-bis(trifluoromethyl)phenyl]formamide;N-(2-fluoro-3-methylphenyl)benzamide.
| Compound Name | N-[4-[1-(difluoroamino)-1,2,2,2-tetrafluoroethyl]-2,6-bis(trifluoromethyl)phenyl]formamide;N-(2-fluoro-3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 143940757 |
| Molecular Formula | C25H16F13N3O2 |
| Molecular Weight | 637.40 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | N-[4-[1-(difluoroamino)-1,2,2,2-tetrafluoroethyl]-2,6-bis(trifluoromethyl)phenyl]formamide;N-(2-fluoro-3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2)c1F.O=CNc1c(C(F)(F)F)cc(C(F)(N(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H12FNO.C11H4F12N2O/c1-10-6-5-9-12(13(10)15)16-14(17)11-7-3-2-4-8-11;12-8(25(22)23,11(19,20)21)4-1-5(9(13,14)15)7(24-3-26)6(2-4)10(16,17)18/h2-9H,1H3,(H,16,17);1-3H,(H,24,26) |
| InChIKey | OZOXFHFFDRZFMH-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.40 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|