C21H21F11N2O — CID 143933701
ethane;2-fluoro-3-methylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide (PubChem CID 143933701) has the molecular formula C21H21F11N2O and a molecular weight of 526.39 g/mol. Its IUPAC name is ethane;2-fluoro-3-methylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide.
| Compound Name | ethane;2-fluoro-3-methylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 143933701 |
| Molecular Formula | C21H21F11N2O |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | ethane;2-fluoro-3-methylaniline;N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]formamide |
| SMILES | CC.Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1NC=O.Cc1cccc(N)c1F |
| InChI | InChI=1S/C12H7F10NO.C7H8FN.C2H6/c1-5-2-6(9(13,11(17,18)19)12(20,21)22)3-7(10(14,15)16)8(5)23-4-24;1-5-3-2-4-6(9)7(5)8;1-2/h2-4H,1H3,(H,23,24);2-4H,9H2,1H3;1-2H3 |
| InChIKey | SUPNLWFURVZKAD-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|