C18H11F11N2O — CID 89104206
3-amino-4-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide (PubChem CID 89104206) has the molecular formula C18H11F11N2O and a molecular weight of 480.28 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-amino-4-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 89104206 |
| Molecular Formula | C18H11F11N2O |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-amino-4-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1NC(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C18H11F11N2O/c1-7-4-9(15(20,17(24,25)26)18(27,28)29)6-10(16(21,22)23)13(7)31-14(32)8-2-3-11(19)12(30)5-8/h2-6H,30H2,1H3,(H,31,32) |
| InChIKey | UYPCSYJKHWMCPL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|