C20H20F7N3O — CID 59202372
3-amino-4-(dimethylamino)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide (PubChem CID 59202372) has the molecular formula C20H20F7N3O and a molecular weight of 451.39 g/mol. Its IUPAC name is 3-amino-4-(dimethylamino)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide.
| Compound Name | 3-amino-4-(dimethylamino)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
|---|---|
| PubChem CID | 59202372 |
| Molecular Formula | C20H20F7N3O |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 3-amino-4-(dimethylamino)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(N(C)C)c(N)c1 |
| InChI | InChI=1S/C20H20F7N3O/c1-10-7-13(18(21,19(22,23)24)20(25,26)27)8-11(2)16(10)29-17(31)12-5-6-15(30(3)4)14(28)9-12/h5-9H,28H2,1-4H3,(H,29,31) |
| InChIKey | DUGOSHOMBSUKJM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|