C22H18F7N3O3 — CID 25014224
ethyl N-[2-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate (PubChem CID 25014224) has the molecular formula C22H18F7N3O3 and a molecular weight of 505.39 g/mol. Its IUPAC name is ethyl N-[2-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[2-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 25014224 |
| Molecular Formula | C22H18F7N3O3 |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | ethyl N-[2-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(C(=O)Nc2c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C)ccc1C#N |
| InChI | InChI=1S/C22H18F7N3O3/c1-4-35-19(34)31-16-9-13(5-6-14(16)10-30)18(33)32-17-11(2)7-15(8-12(17)3)20(23,21(24,25)26)22(27,28)29/h5-9H,4H2,1-3H3,(H,31,34)(H,32,33) |
| InChIKey | SNZCPOTZVBCBLP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |