C23H23F7N2O — CID 163858868
4-(aminomethyl)-3-cyclobutyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide (PubChem CID 163858868) has the molecular formula C23H23F7N2O and a molecular weight of 476.44 g/mol. Its IUPAC name is 4-(aminomethyl)-3-cyclobutyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide.
| Compound Name | 4-(aminomethyl)-3-cyclobutyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
|---|---|
| PubChem CID | 163858868 |
| Molecular Formula | C23H23F7N2O |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 4-(aminomethyl)-3-cyclobutyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(CN)c(C2CCC2)c1 |
| InChI | InChI=1S/C23H23F7N2O/c1-12-8-17(21(24,22(25,26)27)23(28,29)30)9-13(2)19(12)32-20(33)15-6-7-16(11-31)18(10-15)14-4-3-5-14/h6-10,14H,3-5,11,31H2,1-2H3,(H,32,33) |
| InChIKey | PATGAIPLCLDHMD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |