C20H16BrClF7NO — CID 88531405
3-bromo-4-(chloromethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]benzamide (PubChem CID 88531405) has the molecular formula C20H16BrClF7NO and a molecular weight of 534.70 g/mol. Its IUPAC name is 3-bromo-4-(chloromethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]benzamide.
| Compound Name | 3-bromo-4-(chloromethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]benzamide |
|---|---|
| PubChem CID | 88531405 |
| Molecular Formula | C20H16BrClF7NO |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 533.00 |
| IUPAC Name | 3-bromo-4-(chloromethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]benzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(CCl)c(Br)c1 |
| InChI | InChI=1S/C20H16BrClF7NO/c1-3-11-7-14(18(23,19(24,25)26)20(27,28)29)6-10(2)16(11)30-17(31)12-4-5-13(9-22)15(21)8-12/h4-8H,3,9H2,1-2H3,(H,30,31) |
| InChIKey | MRAQWRKOSONEJC-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|