C27H15F12N3O6 — CID 156509559
[3-[[3-(carboxyamino)-2-fluorobenzoyl]-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]carbamic acid (PubChem CID 156509559) has the molecular formula C27H15F12N3O6 and a molecular weight of 705.41 g/mol. Its IUPAC name is [3-[[3-(carboxyamino)-2-fluorobenzoyl]-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]carbamic acid.
| Compound Name | [3-[[3-(carboxyamino)-2-fluorobenzoyl]-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]carbamic acid |
|---|---|
| PubChem CID | 156509559 |
| Molecular Formula | C27H15F12N3O6 |
| Molecular Weight | 705.41 g/mol |
| Exact Mass | 705.08 |
| IUPAC Name | [3-[[3-(carboxyamino)-2-fluorobenzoyl]-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]carbamic acid |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1N(C(=O)c1cccc(NC(=O)O)c1F)C(=O)c1cccc(NC(=O)O)c1F |
| InChI | InChI=1S/C27H15F12N3O6/c1-10-8-11(24(30,26(34,35)36)27(37,38)39)9-14(25(31,32)33)19(10)42(20(43)12-4-2-6-15(17(12)28)40-22(45)46)21(44)13-5-3-7-16(18(13)29)41-23(47)48/h2-9,40-41H,1H3,(H,45,46)(H,47,48) |
| InChIKey | DHSIJEWMNATPAD-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.41 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|