C21H10BrF11N2O4 — CID 172552532
N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-N-(cyclopropanecarbonyl)-2-fluoro-3-nitrobenzamide (PubChem CID 172552532) has the molecular formula C21H10BrF11N2O4 and a molecular weight of 643.20 g/mol. Its IUPAC name is N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-N-(cyclopropanecarbonyl)-2-fluoro-3-nitrobenzamide.
| Compound Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-N-(cyclopropanecarbonyl)-2-fluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 172552532 |
| Molecular Formula | C21H10BrF11N2O4 |
| Molecular Weight | 643.20 g/mol |
| Exact Mass | 641.96 |
| IUPAC Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-N-(cyclopropanecarbonyl)-2-fluoro-3-nitrobenzamide |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1F)N(C(=O)C1CC1)c1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H10BrF11N2O4/c22-12-7-9(18(24,20(28,29)30)21(31,32)33)6-11(19(25,26)27)15(12)34(16(36)8-4-5-8)17(37)10-2-1-3-13(14(10)23)35(38)39/h1-3,6-8H,4-5H2 |
| InChIKey | NVONUEVLNGUWPD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.20 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|