C28H19BrF8N2O3 — CID 172552530
3-benzamido-N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-N-(cyclopropanecarbonyl)-2-fluorobenzamide (PubChem CID 172552530) has the molecular formula C28H19BrF8N2O3 and a molecular weight of 663.36 g/mol. Its IUPAC name is 3-benzamido-N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-N-(cyclopropanecarbonyl)-2-fluorobenzamide.
| Compound Name | 3-benzamido-N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-N-(cyclopropanecarbonyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 172552530 |
| Molecular Formula | C28H19BrF8N2O3 |
| Molecular Weight | 663.36 g/mol |
| Exact Mass | 662.05 |
| IUPAC Name | 3-benzamido-N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-N-(cyclopropanecarbonyl)-2-fluorobenzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(Br)c1N(C(=O)c1cccc(NC(=O)c2ccccc2)c1F)C(=O)C1CC1 |
| InChI | InChI=1S/C28H19BrF8N2O3/c1-14-12-17(26(31,27(32,33)34)28(35,36)37)13-19(29)22(14)39(24(41)16-10-11-16)25(42)18-8-5-9-20(21(18)30)38-23(40)15-6-3-2-4-7-15/h2-9,12-13,16H,10-11H2,1H3,(H,38,40) |
| InChIKey | RMMKXWBYLUXXRS-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.36 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|