C29H25F7N2O4 — CID 58297491
methyl 3-[N-(3-benzamidobenzoyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanoate (PubChem CID 58297491) has the molecular formula C29H25F7N2O4 and a molecular weight of 598.52 g/mol. Its IUPAC name is methyl 3-[N-(3-benzamidobenzoyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanoate.
| Compound Name | methyl 3-[N-(3-benzamidobenzoyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanoate |
|---|---|
| PubChem CID | 58297491 |
| Molecular Formula | C29H25F7N2O4 |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | methyl 3-[N-(3-benzamidobenzoyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanoate |
| SMILES | COC(=O)CCN(C(=O)c1cccc(NC(=O)c2ccccc2)c1)c1c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C29H25F7N2O4/c1-17-14-21(27(30,28(31,32)33)29(34,35)36)15-18(2)24(17)38(13-12-23(39)42-3)26(41)20-10-7-11-22(16-20)37-25(40)19-8-5-4-6-9-19/h4-11,14-16H,12-13H2,1-3H3,(H,37,40) |
| InChIKey | OAWZVMIFIUTPMA-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |