C24H27F7N4O3 — CID 146384108
3-[(3-amino-3-hydroxypropyl)amino]-N-(3-amino-3-oxopropyl)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide (PubChem CID 146384108) has the molecular formula C24H27F7N4O3 and a molecular weight of 552.49 g/mol. Its IUPAC name is 3-[(3-amino-3-hydroxypropyl)amino]-N-(3-amino-3-oxopropyl)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide.
| Compound Name | 3-[(3-amino-3-hydroxypropyl)amino]-N-(3-amino-3-oxopropyl)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
|---|---|
| PubChem CID | 146384108 |
| Molecular Formula | C24H27F7N4O3 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 3-[(3-amino-3-hydroxypropyl)amino]-N-(3-amino-3-oxopropyl)-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1N(CCC(N)=O)C(=O)c1cccc(NCCC(N)O)c1 |
| InChI | InChI=1S/C24H27F7N4O3/c1-13-10-16(22(25,23(26,27)28)24(29,30)31)11-14(2)20(13)35(9-7-19(33)37)21(38)15-4-3-5-17(12-15)34-8-6-18(32)36/h3-5,10-12,18,34,36H,6-9,32H2,1-2H3,(H2,33,37) |
| InChIKey | OEHLOZMVNGCLKS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|