C29H27F7N2O4S — CID 58297480
3-[benzoyl(2-methylsulfonylethyl)amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-N-methylbenzamide (PubChem CID 58297480) has the molecular formula C29H27F7N2O4S and a molecular weight of 632.60 g/mol. Its IUPAC name is 3-[benzoyl(2-methylsulfonylethyl)amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-N-methylbenzamide.
| Compound Name | 3-[benzoyl(2-methylsulfonylethyl)amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58297480 |
| Molecular Formula | C29H27F7N2O4S |
| Molecular Weight | 632.60 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | 3-[benzoyl(2-methylsulfonylethyl)amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-N-methylbenzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1N(C)C(=O)c1cccc(N(CCS(C)(=O)=O)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H27F7N2O4S/c1-18-15-22(27(30,28(31,32)33)29(34,35)36)16-19(2)24(18)37(3)25(39)21-11-8-12-23(17-21)38(13-14-43(4,41)42)26(40)20-9-6-5-7-10-20/h5-12,15-17H,13-14H2,1-4H3 |
| InChIKey | BSTMWFIKOGBLET-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |