C29H26F7N3O3 — CID 58297414
N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-[3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]phenyl]benzamide (PubChem CID 58297414) has the molecular formula C29H26F7N3O3 and a molecular weight of 597.53 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-[3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]phenyl]benzamide.
| Compound Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-[3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58297414 |
| Molecular Formula | C29H26F7N3O3 |
| Molecular Weight | 597.53 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-[3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]phenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1CC(=O)c1cccc(N(CC/C(N)=N/O)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H26F7N3O3/c1-17-13-21(27(30,28(31,32)33)29(34,35)36)14-18(2)23(17)16-24(40)20-9-6-10-22(15-20)39(12-11-25(37)38-42)26(41)19-7-4-3-5-8-19/h3-10,13-15,42H,11-12,16H2,1-2H3,(H2,37,38) |
| InChIKey | LUCVRERQDXASOQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|