C30H29F7N4O3 — CID 87301311
3-[benzoyl-[3-(methylcarbamoylamino)propyl]amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-N-methylbenzamide (PubChem CID 87301311) has the molecular formula C30H29F7N4O3 and a molecular weight of 626.57 g/mol. Its IUPAC name is 3-[benzoyl-[3-(methylcarbamoylamino)propyl]amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-N-methylbenzamide.
| Compound Name | 3-[benzoyl-[3-(methylcarbamoylamino)propyl]amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 87301311 |
| Molecular Formula | C30H29F7N4O3 |
| Molecular Weight | 626.57 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | 3-[benzoyl-[3-(methylcarbamoylamino)propyl]amino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-N-methylbenzamide |
| SMILES | CNC(=O)NCCCN(C(=O)c1ccccc1)c1cccc(C(=O)N(C)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2C)c1 |
| InChI | InChI=1S/C30H29F7N4O3/c1-19-17-22(28(31,29(32,33)34)30(35,36)37)13-14-24(19)40(3)25(42)21-11-7-12-23(18-21)41(16-8-15-39-27(44)38-2)26(43)20-9-5-4-6-10-20/h4-7,9-14,17-18H,8,15-16H2,1-3H3,(H2,38,39,44) |
| InChIKey | GHSXQXUCEOOGIT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|